About 1-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid
1-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 99576677) has the molecular formula C15H24N2O4
and a molecular weight of 296.37 g/mol. Its IUPAC name is 1-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid |
| PubChem CID | 99576677 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 1-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | CC(C)NC(=O)[C@H]1CCC[C@@H](NC(=O)C2(C(=O)O)CC2)C1 |
| InChI | InChI=1S/C15H24N2O4/c1-9(2)16-12(18)10-4-3-5-11(8-10)17-13(19)15(6-7-15)14(20)21/h9-11H,3-8H2,1-2H3,(H,16,18)(H,17,19)(H,20,21)/t10-,11+/m0/s1 |
| InChIKey | TWEKWENMMJLTMW-WDEREUQCSA-N |
| XLogP | 1.05 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid?
The IUPAC name of 1-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid (CID 99576677) is 1-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid.
What is the SMILES notation for 1-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid?
The canonical SMILES for 1-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid is CC(C)NC(=O)[C@H]1CCC[C@@H](NC(=O)C2(C(=O)O)CC2)C1.
What is the InChIKey of 1-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid?
The InChIKey is TWEKWENMMJLTMW-WDEREUQCSA-N. The full InChI is InChI=1S/C15H24N2O4/c1-9(2)16-12(18)10-4-3-5-11(8-10)17-13(19)15(6-7-15)14(20)21/h9-11H,3-8H2,1-2H3,(H,16,18)(H,17,19)(H,20,21)/t10-,11+/m0/s1.
What are the key properties of 1-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid?
1-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid has a molecular weight of 296.37 g/mol, XLogP of 1.05, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(1R,3S)-3-(propan-2-ylcarbamoyl)cyclohexyl]carbamoyl]cyclopropane-1-carboxylic acid is sourced from PubChem (CID 99576677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).