C17H23N3OS — CID 99576842
N-[(7S)-2-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]-N,3,5-trimethyl-1H-pyrrole-2-carboxamide (PubChem CID 99576842) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is N-[(7S)-2-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]-N,3,5-trimethyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(7S)-2-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]-N,3,5-trimethyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 99576842 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N-[(7S)-2-ethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]-N,3,5-trimethyl-1H-pyrrole-2-carboxamide |
| SMILES | CCc1nc2c(s1)[C@@H](N(C)C(=O)c1[nH]c(C)cc1C)CCC2 |
| InChI | InChI=1S/C17H23N3OS/c1-5-14-19-12-7-6-8-13(16(12)22-14)20(4)17(21)15-10(2)9-11(3)18-15/h9,13,18H,5-8H2,1-4H3/t13-/m0/s1 |
| InChIKey | OYPYIOFDPBGRND-ZDUSSCGKSA-N |
| XLogP | 3.80 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |