C14H18N2O5 — CID 99577391
4-hydroxy-3-nitro-N-[(1R)-1-(oxan-4-yl)ethyl]benzamide (PubChem CID 99577391) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-hydroxy-3-nitro-N-[(1R)-1-(oxan-4-yl)ethyl]benzamide.
| Compound Name | 4-hydroxy-3-nitro-N-[(1R)-1-(oxan-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 99577391 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4-hydroxy-3-nitro-N-[(1R)-1-(oxan-4-yl)ethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(O)c([N+](=O)[O-])c1)C1CCOCC1 |
| InChI | InChI=1S/C14H18N2O5/c1-9(10-4-6-21-7-5-10)15-14(18)11-2-3-13(17)12(8-11)16(19)20/h2-3,8-10,17H,4-7H2,1H3,(H,15,18)/t9-/m1/s1 |
| InChIKey | UJBQCBNNZYBYRB-SECBINFHSA-N |
| XLogP | 1.85 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|