C23H34O3 — CID 99578133
[(1S,2R,5R,7R,10R,11S,14R,15S)-14-acetyl-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl] acetate (PubChem CID 99578133) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is [(1S,2R,5R,7R,10R,11S,14R,15S)-14-acetyl-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl] acetate.
| Compound Name | [(1S,2R,5R,7R,10R,11S,14R,15S)-14-acetyl-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl] acetate |
|---|---|
| PubChem CID | 99578133 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | [(1S,2R,5R,7R,10R,11S,14R,15S)-14-acetyl-2,15-dimethyl-14-pentacyclo[8.7.0.02,7.05,7.011,15]heptadecanyl] acetate |
| SMILES | CC(=O)O[C@]1(C(C)=O)CC[C@H]2[C@@H]3CC[C@@]45C[C@H]4CC[C@]5(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H34O3/c1-14(24)23(26-15(2)25)12-8-19-17-6-11-22-13-16(22)5-9-20(22,3)18(17)7-10-21(19,23)4/h16-19H,5-13H2,1-4H3/t16-,17-,18+,19+,20-,21+,22-,23+/m1/s1 |
| InChIKey | KTDCVTGLYJBIFI-GTOCWNLFSA-N |
| XLogP | 4.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |