C20H35N3O2 — CID 99579879
4-(2,2-dimethylpropanoyl)-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]piperazine-1-carboxamide (PubChem CID 99579879) has the molecular formula C20H35N3O2 and a molecular weight of 349.52 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoyl)-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]piperazine-1-carboxamide.
| Compound Name | 4-(2,2-dimethylpropanoyl)-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 99579879 |
| Molecular Formula | C20H35N3O2 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.27 |
| IUPAC Name | 4-(2,2-dimethylpropanoyl)-N-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]piperazine-1-carboxamide |
| SMILES | CC(C)(C)C(=O)N1CCN(C(=O)N[C@@H]2C[C@H]3CC[C@@]2(C)C3(C)C)CC1 |
| InChI | InChI=1S/C20H35N3O2/c1-18(2,3)16(24)22-9-11-23(12-10-22)17(25)21-15-13-14-7-8-20(15,6)19(14,4)5/h14-15H,7-13H2,1-6H3,(H,21,25)/t14-,15-,20-/m1/s1 |
| InChIKey | FHBMXHQUJNKBOR-STXHMFSFSA-N |
| XLogP | 3.10 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |