C28H23F3N4O2 — CID 995799
(4R,4aS)-2-amino-4-[4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 995799) has the molecular formula C28H23F3N4O2 and a molecular weight of 504.51 g/mol. Its IUPAC name is (4R,4aS)-2-amino-4-[4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | (4R,4aS)-2-amino-4-[4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 995799 |
| Molecular Formula | C28H23F3N4O2 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | (4R,4aS)-2-amino-4-[4-methoxy-3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | COc1ccc([C@H]2[C@@H]3CCCC=C3C(C#N)=C(N)C2(C#N)C#N)cc1COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H23F3N4O2/c1-36-24-10-9-17(11-18(24)14-37-20-6-4-5-19(12-20)28(29,30)31)25-22-8-3-2-7-21(22)23(13-32)26(35)27(25,15-33)16-34/h4-7,9-12,22,25H,2-3,8,14,35H2,1H3/t22-,25+/m1/s1 |
| InChIKey | XSDQNVBPDRIHCY-RDGATRHJSA-N |
| XLogP | 5.89 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|