C16H16N4O3 — CID 99584076
(2S,3S)-3-methyl-N-(3-nitro-4-pyridinyl)-2-phenylazetidine-1-carboxamide (PubChem CID 99584076) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is (2S,3S)-3-methyl-N-(3-nitro-4-pyridinyl)-2-phenylazetidine-1-carboxamide.
| Compound Name | (2S,3S)-3-methyl-N-(3-nitro-4-pyridinyl)-2-phenylazetidine-1-carboxamide |
|---|---|
| PubChem CID | 99584076 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (2S,3S)-3-methyl-N-(3-nitro-4-pyridinyl)-2-phenylazetidine-1-carboxamide |
| SMILES | C[C@H]1CN(C(=O)Nc2ccncc2[N+](=O)[O-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H16N4O3/c1-11-10-19(15(11)12-5-3-2-4-6-12)16(21)18-13-7-8-17-9-14(13)20(22)23/h2-9,11,15H,10H2,1H3,(H,17,18,21)/t11-,15-/m0/s1 |
| InChIKey | CYAIYJAKRUAPTI-NHYWBVRUSA-N |
| XLogP | 3.21 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|