C17H22FN3O2 — CID 99584722
N-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)azocane-1-carboxamide (PubChem CID 99584722) has the molecular formula C17H22FN3O2 and a molecular weight of 319.38 g/mol. Its IUPAC name is N-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)azocane-1-carboxamide.
| Compound Name | N-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)azocane-1-carboxamide |
|---|---|
| PubChem CID | 99584722 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-(7-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)azocane-1-carboxamide |
| SMILES | O=C1CCc2cc(NC(=O)N3CCCCCCC3)c(F)cc2N1 |
| InChI | InChI=1S/C17H22FN3O2/c18-13-11-14-12(6-7-16(22)19-14)10-15(13)20-17(23)21-8-4-2-1-3-5-9-21/h10-11H,1-9H2,(H,19,22)(H,20,23) |
| InChIKey | VPBLRZBDZGHELG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |