About 3-[3-[1,3-benzodioxol-5-yl(methyl)amino]propyl]-5-nitro-1,3-benzoxazol-2-one
3-[3-[1,3-benzodioxol-5-yl(methyl)amino]propyl]-5-nitro-1,3-benzoxazol-2-one (PubChem CID 99588923) has the molecular formula C18H17N3O6
and a molecular weight of 371.35 g/mol. Its IUPAC name is 3-[3-[1,3-benzodioxol-5-yl(methyl)amino]propyl]-5-nitro-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 3-[3-[1,3-benzodioxol-5-yl(methyl)amino]propyl]-5-nitro-1,3-benzoxazol-2-one |
| PubChem CID | 99588923 |
| Molecular Formula | C18H17N3O6 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 3-[3-[1,3-benzodioxol-5-yl(methyl)amino]propyl]-5-nitro-1,3-benzoxazol-2-one |
| SMILES | CN(CCCn1c(=O)oc2ccc([N+](=O)[O-])cc21)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H17N3O6/c1-19(12-3-6-16-17(10-12)26-11-25-16)7-2-8-20-14-9-13(21(23)24)4-5-15(14)27-18(20)22/h3-6,9-10H,2,7-8,11H2,1H3 |
| InChIKey | LZAKDCUEJMXPMK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 99.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[1,3-benzodioxol-5-yl(methyl)amino]propyl]-5-nitro-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[1,3-benzodioxol-5-yl(methyl)amino]propyl]-5-nitro-1,3-benzoxazol-2-one?
The IUPAC name of 3-[3-[1,3-benzodioxol-5-yl(methyl)amino]propyl]-5-nitro-1,3-benzoxazol-2-one (CID 99588923) is 3-[3-[1,3-benzodioxol-5-yl(methyl)amino]propyl]-5-nitro-1,3-benzoxazol-2-one.
What is the SMILES notation for 3-[3-[1,3-benzodioxol-5-yl(methyl)amino]propyl]-5-nitro-1,3-benzoxazol-2-one?
The canonical SMILES for 3-[3-[1,3-benzodioxol-5-yl(methyl)amino]propyl]-5-nitro-1,3-benzoxazol-2-one is CN(CCCn1c(=O)oc2ccc([N+](=O)[O-])cc21)c1ccc2c(c1)OCO2.
What is the InChIKey of 3-[3-[1,3-benzodioxol-5-yl(methyl)amino]propyl]-5-nitro-1,3-benzoxazol-2-one?
The InChIKey is LZAKDCUEJMXPMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O6/c1-19(12-3-6-16-17(10-12)26-11-25-16)7-2-8-20-14-9-13(21(23)24)4-5-15(14)27-18(20)22/h3-6,9-10H,2,7-8,11H2,1H3.
What are the key properties of 3-[3-[1,3-benzodioxol-5-yl(methyl)amino]propyl]-5-nitro-1,3-benzoxazol-2-one?
3-[3-[1,3-benzodioxol-5-yl(methyl)amino]propyl]-5-nitro-1,3-benzoxazol-2-one has a molecular weight of 371.35 g/mol, XLogP of 2.76, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[1,3-benzodioxol-5-yl(methyl)amino]propyl]-5-nitro-1,3-benzoxazol-2-one is sourced from PubChem (CID 99588923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).