C18H25FN4OS — CID 99589094
(5R,7R)-N-[2-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-fluoroadamantane-1-carboxamide (PubChem CID 99589094) has the molecular formula C18H25FN4OS and a molecular weight of 364.49 g/mol. Its IUPAC name is (5R,7R)-N-[2-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-fluoroadamantane-1-carboxamide.
| Compound Name | (5R,7R)-N-[2-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-fluoroadamantane-1-carboxamide |
|---|---|
| PubChem CID | 99589094 |
| Molecular Formula | C18H25FN4OS |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (5R,7R)-N-[2-(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-fluoroadamantane-1-carboxamide |
| SMILES | O=C(NCCc1n[nH]c(=S)n1C1CC1)C12C[C@H]3C[C@@H](CC(F)(C3)C1)C2 |
| InChI | InChI=1S/C18H25FN4OS/c19-18-8-11-5-12(9-18)7-17(6-11,10-18)15(24)20-4-3-14-21-22-16(25)23(14)13-1-2-13/h11-13H,1-10H2,(H,20,24)(H,22,25)/t11-,12-,17?,18?/m1/s1 |
| InChIKey | CKWNUCKUIQUWPT-SKLAPFLYSA-N |
| XLogP | 3.24 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|