C15H15N3OS3 — CID 99589839
N-[[(1R,1aS,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]methyl]-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetamide (PubChem CID 99589839) has the molecular formula C15H15N3OS3 and a molecular weight of 349.51 g/mol. Its IUPAC name is N-[[(1R,1aS,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]methyl]-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetamide.
| Compound Name | N-[[(1R,1aS,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]methyl]-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 99589839 |
| Molecular Formula | C15H15N3OS3 |
| Molecular Weight | 349.51 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | N-[[(1R,1aS,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]methyl]-2-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1n[nH]c(=S)s1)NC[C@@H]1[C@H]2Cc3ccccc3[C@H]12 |
| InChI | InChI=1S/C15H15N3OS3/c19-12(7-21-15-18-17-14(20)22-15)16-6-11-10-5-8-3-1-2-4-9(8)13(10)11/h1-4,10-11,13H,5-7H2,(H,16,19)(H,17,20)/t10-,11-,13+/m1/s1 |
| InChIKey | ZZXOHKUZLXQZQW-WZRBSPASSA-N |
| XLogP | 2.99 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|