About [(1S)-1-cyano-2-methylpropyl] 3-(3,6-dioxo-1H-pyridazin-2-yl)benzoate
[(1S)-1-cyano-2-methylpropyl] 3-(3,6-dioxo-1H-pyridazin-2-yl)benzoate (PubChem CID 99590270) has the molecular formula C16H15N3O4
and a molecular weight of 313.31 g/mol. Its IUPAC name is [(1S)-1-cyano-2-methylpropyl] 3-(3,6-dioxo-1H-pyridazin-2-yl)benzoate.
Molecular Properties
| Compound Name | [(1S)-1-cyano-2-methylpropyl] 3-(3,6-dioxo-1H-pyridazin-2-yl)benzoate |
| PubChem CID | 99590270 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | [(1S)-1-cyano-2-methylpropyl] 3-(3,6-dioxo-1H-pyridazin-2-yl)benzoate |
| SMILES | CC(C)[C@@H](C#N)OC(=O)c1cccc(-n2[nH]c(=O)ccc2=O)c1 |
| InChI | InChI=1S/C16H15N3O4/c1-10(2)13(9-17)23-16(22)11-4-3-5-12(8-11)19-15(21)7-6-14(20)18-19/h3-8,10,13H,1-2H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | NGOJSXFQVMMLJJ-CYBMUJFWSA-N |
| XLogP | 1.23 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(1S)-1-cyano-2-methylpropyl] 3-(3,6-dioxo-1H-pyridazin-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-cyano-2-methylpropyl] 3-(3,6-dioxo-1H-pyridazin-2-yl)benzoate?
The IUPAC name of [(1S)-1-cyano-2-methylpropyl] 3-(3,6-dioxo-1H-pyridazin-2-yl)benzoate (CID 99590270) is [(1S)-1-cyano-2-methylpropyl] 3-(3,6-dioxo-1H-pyridazin-2-yl)benzoate.
What is the SMILES notation for [(1S)-1-cyano-2-methylpropyl] 3-(3,6-dioxo-1H-pyridazin-2-yl)benzoate?
The canonical SMILES for [(1S)-1-cyano-2-methylpropyl] 3-(3,6-dioxo-1H-pyridazin-2-yl)benzoate is CC(C)[C@@H](C#N)OC(=O)c1cccc(-n2[nH]c(=O)ccc2=O)c1.
What is the InChIKey of [(1S)-1-cyano-2-methylpropyl] 3-(3,6-dioxo-1H-pyridazin-2-yl)benzoate?
The InChIKey is NGOJSXFQVMMLJJ-CYBMUJFWSA-N. The full InChI is InChI=1S/C16H15N3O4/c1-10(2)13(9-17)23-16(22)11-4-3-5-12(8-11)19-15(21)7-6-14(20)18-19/h3-8,10,13H,1-2H3,(H,18,20)/t13-/m1/s1.
What are the key properties of [(1S)-1-cyano-2-methylpropyl] 3-(3,6-dioxo-1H-pyridazin-2-yl)benzoate?
[(1S)-1-cyano-2-methylpropyl] 3-(3,6-dioxo-1H-pyridazin-2-yl)benzoate has a molecular weight of 313.31 g/mol, XLogP of 1.23, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-cyano-2-methylpropyl] 3-(3,6-dioxo-1H-pyridazin-2-yl)benzoate is sourced from PubChem (CID 99590270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).