C16H19ClN2O3 — CID 99593979
N-(2-chloro-4-methylphenyl)-2-[(1S,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoacetamide (PubChem CID 99593979) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-2-[(1S,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoacetamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-2-[(1S,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 99593979 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-2-[(1S,5S)-3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoacetamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N2[C@H]3CC[C@H]2CC(O)C3)c(Cl)c1 |
| InChI | InChI=1S/C16H19ClN2O3/c1-9-2-5-14(13(17)6-9)18-15(21)16(22)19-10-3-4-11(19)8-12(20)7-10/h2,5-6,10-12,20H,3-4,7-8H2,1H3,(H,18,21)/t10-,11-/m0/s1 |
| InChIKey | AATUPRXPGGCFGG-QWRGUYRKSA-N |
| XLogP | 2.10 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|