About 5-methoxy-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]pentanamide
5-methoxy-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]pentanamide (PubChem CID 99595777) has the molecular formula C13H22F3NO2
and a molecular weight of 281.32 g/mol. Its IUPAC name is 5-methoxy-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]pentanamide.
Molecular Properties
| Compound Name | 5-methoxy-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]pentanamide |
| PubChem CID | 99595777 |
| Molecular Formula | C13H22F3NO2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 5-methoxy-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]pentanamide |
| SMILES | COCCCCC(=O)N[C@@H]1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C13H22F3NO2/c1-19-8-3-2-7-12(18)17-11-6-4-5-10(9-11)13(14,15)16/h10-11H,2-9H2,1H3,(H,17,18)/t10-,11+/m0/s1 |
| InChIKey | WMVJCCCSSFVQGM-WDEREUQCSA-N |
| XLogP | 3.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]pentanamide?
The IUPAC name of 5-methoxy-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]pentanamide (CID 99595777) is 5-methoxy-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]pentanamide.
What is the SMILES notation for 5-methoxy-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]pentanamide?
The canonical SMILES for 5-methoxy-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]pentanamide is COCCCCC(=O)N[C@@H]1CCC[C@H](C(F)(F)F)C1.
What is the InChIKey of 5-methoxy-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]pentanamide?
The InChIKey is WMVJCCCSSFVQGM-WDEREUQCSA-N. The full InChI is InChI=1S/C13H22F3NO2/c1-19-8-3-2-7-12(18)17-11-6-4-5-10(9-11)13(14,15)16/h10-11H,2-9H2,1H3,(H,17,18)/t10-,11+/m0/s1.
What are the key properties of 5-methoxy-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]pentanamide?
5-methoxy-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]pentanamide has a molecular weight of 281.32 g/mol, XLogP of 3.04, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-N-[(1R,3S)-3-(trifluoromethyl)cyclohexyl]pentanamide is sourced from PubChem (CID 99595777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).