C13H22N4O2 — CID 99598507
N'-[(2R)-3,3-dimethylbutan-2-yl]-N-(2,5-dimethylpyrazol-3-yl)oxamide (PubChem CID 99598507) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is N'-[(2R)-3,3-dimethylbutan-2-yl]-N-(2,5-dimethylpyrazol-3-yl)oxamide.
| Compound Name | N'-[(2R)-3,3-dimethylbutan-2-yl]-N-(2,5-dimethylpyrazol-3-yl)oxamide |
|---|---|
| PubChem CID | 99598507 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | N'-[(2R)-3,3-dimethylbutan-2-yl]-N-(2,5-dimethylpyrazol-3-yl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)N[C@H](C)C(C)(C)C)n(C)n1 |
| InChI | InChI=1S/C13H22N4O2/c1-8-7-10(17(6)16-8)15-12(19)11(18)14-9(2)13(3,4)5/h7,9H,1-6H3,(H,14,18)(H,15,19)/t9-/m1/s1 |
| InChIKey | ROSOLBJFVOBRMK-SECBINFHSA-N |
| XLogP | 1.22 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|