C27H40O8 — CID 99601628
[(5S,6S,8S,9S,10S,11S,12R,13R,14S)-11,12-diacetyloxy-10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-6-yl] acetate (PubChem CID 99601628) has the molecular formula C27H40O8 and a molecular weight of 492.61 g/mol. Its IUPAC name is [(5S,6S,8S,9S,10S,11S,12R,13R,14S)-11,12-diacetyloxy-10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-6-yl] acetate.
| Compound Name | [(5S,6S,8S,9S,10S,11S,12R,13R,14S)-11,12-diacetyloxy-10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-6-yl] acetate |
|---|---|
| PubChem CID | 99601628 |
| Molecular Formula | C27H40O8 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | [(5S,6S,8S,9S,10S,11S,12R,13R,14S)-11,12-diacetyloxy-10,13-dimethylspiro[1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H]2[C@@H](C[C@H](OC(C)=O)[C@H]3CC4(CC[C@]23C)OCCO4)[C@@H]2CCC[C@@]2(C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C27H40O8/c1-15(28)33-21-13-18-19-7-6-8-26(19,5)24(35-17(3)30)23(34-16(2)29)22(18)25(4)9-10-27(14-20(21)25)31-11-12-32-27/h18-24H,6-14H2,1-5H3/t18-,19-,20+,21-,22+,23-,24-,25-,26+/m0/s1 |
| InChIKey | ZXPXOMWDXZTQRM-CBIJTAIPSA-N |
| XLogP | 3.79 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|