C26H32Cl2O2 — CID 99602044
(3R,8R,9S,10R,13S,14S,16E,17R)-16-[(2,4-dichlorophenyl)methylidene]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 99602044) has the molecular formula C26H32Cl2O2 and a molecular weight of 447.45 g/mol. Its IUPAC name is (3R,8R,9S,10R,13S,14S,16E,17R)-16-[(2,4-dichlorophenyl)methylidene]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (3R,8R,9S,10R,13S,14S,16E,17R)-16-[(2,4-dichlorophenyl)methylidene]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 99602044 |
| Molecular Formula | C26H32Cl2O2 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (3R,8R,9S,10R,13S,14S,16E,17R)-16-[(2,4-dichlorophenyl)methylidene]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@H](O)CC[C@@]43C)[C@@H]1C/C(=C\c1ccc(Cl)cc1Cl)[C@H]2O |
| InChI | InChI=1S/C26H32Cl2O2/c1-25-9-7-19(29)13-17(25)4-6-20-21(25)8-10-26(2)22(20)12-16(24(26)30)11-15-3-5-18(27)14-23(15)28/h3-5,11,14,19-22,24,29-30H,6-10,12-13H2,1-2H3/b16-11+/t19-,20-,21+,22+,24-,25+,26+/m1/s1 |
| InChIKey | UVKLEPAXPBFJMQ-IVDXEQOSSA-N |
| XLogP | 6.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|