C13H12F3N3O2S — CID 99603105
N-methyl-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide (PubChem CID 99603105) has the molecular formula C13H12F3N3O2S and a molecular weight of 331.32 g/mol. Its IUPAC name is N-methyl-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide.
| Compound Name | N-methyl-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide |
|---|---|
| PubChem CID | 99603105 |
| Molecular Formula | C13H12F3N3O2S |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-methyl-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide |
| SMILES | CN(CCC(F)(F)F)C(=O)c1ccc(-c2n[nH]c(=S)o2)cc1 |
| InChI | InChI=1S/C13H12F3N3O2S/c1-19(7-6-13(14,15)16)11(20)9-4-2-8(3-5-9)10-17-18-12(22)21-10/h2-5H,6-7H2,1H3,(H,18,22) |
| InChIKey | PWAYEZPDLUKLFK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|