C14H13F2N3O2S — CID 99604774
N-cyclopropyl-N-(2,2-difluoroethyl)-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide (PubChem CID 99604774) has the molecular formula C14H13F2N3O2S and a molecular weight of 325.34 g/mol. Its IUPAC name is N-cyclopropyl-N-(2,2-difluoroethyl)-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide.
| Compound Name | N-cyclopropyl-N-(2,2-difluoroethyl)-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 99604774 |
| Molecular Formula | C14H13F2N3O2S |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-cyclopropyl-N-(2,2-difluoroethyl)-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)benzamide |
| SMILES | O=C(c1ccc(-c2n[nH]c(=S)o2)cc1)N(CC(F)F)C1CC1 |
| InChI | InChI=1S/C14H13F2N3O2S/c15-11(16)7-19(10-5-6-10)13(20)9-3-1-8(2-4-9)12-17-18-14(22)21-12/h1-4,10-11H,5-7H2,(H,18,22) |
| InChIKey | HFYVSEXHXOGOQD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|