C17H18N2O3S — CID 99606126
2-[[[(E)-3-(2,4,5-trimethylphenyl)prop-2-enoyl]amino]methyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 99606126) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-[[[(E)-3-(2,4,5-trimethylphenyl)prop-2-enoyl]amino]methyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[[(E)-3-(2,4,5-trimethylphenyl)prop-2-enoyl]amino]methyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 99606126 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-[[[(E)-3-(2,4,5-trimethylphenyl)prop-2-enoyl]amino]methyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1cc(C)c(/C=C/C(=O)NCc2nc(C(=O)O)cs2)cc1C |
| InChI | InChI=1S/C17H18N2O3S/c1-10-6-12(3)13(7-11(10)2)4-5-15(20)18-8-16-19-14(9-23-16)17(21)22/h4-7,9H,8H2,1-3H3,(H,18,20)(H,21,22)/b5-4+ |
| InChIKey | ATQCFEVUPGGJKP-SNAWJCMRSA-N |
| XLogP | 3.10 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|