About 1-(4-fluorophenyl)-N,5-dimethyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide
1-(4-fluorophenyl)-N,5-dimethyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide (PubChem CID 99606683) has the molecular formula C16H18FN7O
and a molecular weight of 343.37 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N,5-dimethyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-N,5-dimethyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide |
| PubChem CID | 99606683 |
| Molecular Formula | C16H18FN7O |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-(4-fluorophenyl)-N,5-dimethyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)C[C@@H](C)c2nn[nH]n2)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H18FN7O/c1-10(15-18-21-22-19-15)9-23(3)16(25)14-8-11(2)24(20-14)13-6-4-12(17)5-7-13/h4-8,10H,9H2,1-3H3,(H,18,19,21,22)/t10-/m1/s1 |
| InChIKey | PQYIYXJGGVETJN-SNVBAGLBSA-N |
| XLogP | 1.71 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-fluorophenyl)-N,5-dimethyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-N,5-dimethyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide?
The IUPAC name of 1-(4-fluorophenyl)-N,5-dimethyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide (CID 99606683) is 1-(4-fluorophenyl)-N,5-dimethyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide.
What is the SMILES notation for 1-(4-fluorophenyl)-N,5-dimethyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide?
The canonical SMILES for 1-(4-fluorophenyl)-N,5-dimethyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide is Cc1cc(C(=O)N(C)C[C@@H](C)c2nn[nH]n2)nn1-c1ccc(F)cc1.
What is the InChIKey of 1-(4-fluorophenyl)-N,5-dimethyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide?
The InChIKey is PQYIYXJGGVETJN-SNVBAGLBSA-N. The full InChI is InChI=1S/C16H18FN7O/c1-10(15-18-21-22-19-15)9-23(3)16(25)14-8-11(2)24(20-14)13-6-4-12(17)5-7-13/h4-8,10H,9H2,1-3H3,(H,18,19,21,22)/t10-/m1/s1.
What are the key properties of 1-(4-fluorophenyl)-N,5-dimethyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide?
1-(4-fluorophenyl)-N,5-dimethyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide has a molecular weight of 343.37 g/mol, XLogP of 1.71, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-N,5-dimethyl-N-[(2R)-2-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide is sourced from PubChem (CID 99606683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).