C15H16FN3O2 — CID 99609775
(3-fluoro-4-pyrazol-1-ylphenyl)-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 99609775) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is (3-fluoro-4-pyrazol-1-ylphenyl)-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (3-fluoro-4-pyrazol-1-ylphenyl)-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 99609775 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | (3-fluoro-4-pyrazol-1-ylphenyl)-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(-n2cccn2)c(F)c1)N1CCC[C@H]1CO |
| InChI | InChI=1S/C15H16FN3O2/c16-13-9-11(4-5-14(13)19-8-2-6-17-19)15(21)18-7-1-3-12(18)10-20/h2,4-6,8-9,12,20H,1,3,7,10H2/t12-/m0/s1 |
| InChIKey | QCPUDDLYPBGHNH-LBPRGKRZSA-N |
| XLogP | 1.61 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |