C14H19N3O3 — CID 99611279
(2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-2-(5-methylfuran-2-yl)propan-2-ol (PubChem CID 99611279) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is (2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-2-(5-methylfuran-2-yl)propan-2-ol.
| Compound Name | (2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-2-(5-methylfuran-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 99611279 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | (2R)-1-[(6-ethoxypyrimidin-4-yl)amino]-2-(5-methylfuran-2-yl)propan-2-ol |
| SMILES | CCOc1cc(NC[C@@](C)(O)c2ccc(C)o2)ncn1 |
| InChI | InChI=1S/C14H19N3O3/c1-4-19-13-7-12(16-9-17-13)15-8-14(3,18)11-6-5-10(2)20-11/h5-7,9,18H,4,8H2,1-3H3,(H,15,16,17)/t14-/m1/s1 |
| InChIKey | ALZLVHQXVJMGRL-CQSZACIVSA-N |
| XLogP | 2.10 |
| TPSA | 80.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |