C13H23NO — CID 99611405
(3S)-2,2,5,5-tetramethyl-N-pent-3-ynyloxolan-3-amine (PubChem CID 99611405) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (3S)-2,2,5,5-tetramethyl-N-pent-3-ynyloxolan-3-amine.
| Compound Name | (3S)-2,2,5,5-tetramethyl-N-pent-3-ynyloxolan-3-amine |
|---|---|
| PubChem CID | 99611405 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (3S)-2,2,5,5-tetramethyl-N-pent-3-ynyloxolan-3-amine |
| SMILES | CC#CCCN[C@H]1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C13H23NO/c1-6-7-8-9-14-11-10-12(2,3)15-13(11,4)5/h11,14H,8-10H2,1-5H3/t11-/m0/s1 |
| InChIKey | LZBDWZDWSMPFBB-NSHDSACASA-N |
| XLogP | 2.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|