About 2-ethyl-N-(4-methoxy-2,3-dimethylphenyl)sulfonyl-1,3-oxazole-4-carboxamide
2-ethyl-N-(4-methoxy-2,3-dimethylphenyl)sulfonyl-1,3-oxazole-4-carboxamide (PubChem CID 99613082) has the molecular formula C15H18N2O5S
and a molecular weight of 338.39 g/mol. Its IUPAC name is 2-ethyl-N-(4-methoxy-2,3-dimethylphenyl)sulfonyl-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-ethyl-N-(4-methoxy-2,3-dimethylphenyl)sulfonyl-1,3-oxazole-4-carboxamide |
| PubChem CID | 99613082 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-ethyl-N-(4-methoxy-2,3-dimethylphenyl)sulfonyl-1,3-oxazole-4-carboxamide |
| SMILES | CCc1nc(C(=O)NS(=O)(=O)c2ccc(OC)c(C)c2C)co1 |
| InChI | InChI=1S/C15H18N2O5S/c1-5-14-16-11(8-22-14)15(18)17-23(19,20)13-7-6-12(21-4)9(2)10(13)3/h6-8H,5H2,1-4H3,(H,17,18) |
| InChIKey | CFSJVOSGYJASTD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-ethyl-N-(4-methoxy-2,3-dimethylphenyl)sulfonyl-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N-(4-methoxy-2,3-dimethylphenyl)sulfonyl-1,3-oxazole-4-carboxamide?
The IUPAC name of 2-ethyl-N-(4-methoxy-2,3-dimethylphenyl)sulfonyl-1,3-oxazole-4-carboxamide (CID 99613082) is 2-ethyl-N-(4-methoxy-2,3-dimethylphenyl)sulfonyl-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2-ethyl-N-(4-methoxy-2,3-dimethylphenyl)sulfonyl-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2-ethyl-N-(4-methoxy-2,3-dimethylphenyl)sulfonyl-1,3-oxazole-4-carboxamide is CCc1nc(C(=O)NS(=O)(=O)c2ccc(OC)c(C)c2C)co1.
What is the InChIKey of 2-ethyl-N-(4-methoxy-2,3-dimethylphenyl)sulfonyl-1,3-oxazole-4-carboxamide?
The InChIKey is CFSJVOSGYJASTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O5S/c1-5-14-16-11(8-22-14)15(18)17-23(19,20)13-7-6-12(21-4)9(2)10(13)3/h6-8H,5H2,1-4H3,(H,17,18).
What are the key properties of 2-ethyl-N-(4-methoxy-2,3-dimethylphenyl)sulfonyl-1,3-oxazole-4-carboxamide?
2-ethyl-N-(4-methoxy-2,3-dimethylphenyl)sulfonyl-1,3-oxazole-4-carboxamide has a molecular weight of 338.39 g/mol, XLogP of 1.98, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-(4-methoxy-2,3-dimethylphenyl)sulfonyl-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 99613082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).