C16H16F3N3O2S — CID 99613162
4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-[4-(trifluoromethyl)cyclohexyl]benzamide (PubChem CID 99613162) has the molecular formula C16H16F3N3O2S and a molecular weight of 371.38 g/mol. Its IUPAC name is 4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-[4-(trifluoromethyl)cyclohexyl]benzamide.
| Compound Name | 4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-[4-(trifluoromethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 99613162 |
| Molecular Formula | C16H16F3N3O2S |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-[4-(trifluoromethyl)cyclohexyl]benzamide |
| SMILES | O=C(NC1CCC(C(F)(F)F)CC1)c1ccc(-c2n[nH]c(=S)o2)cc1 |
| InChI | InChI=1S/C16H16F3N3O2S/c17-16(18,19)11-5-7-12(8-6-11)20-13(23)9-1-3-10(4-2-9)14-21-22-15(25)24-14/h1-4,11-12H,5-8H2,(H,20,23)(H,22,25) |
| InChIKey | RXXORSMHZKGLLC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|