C13H12F3N3O3S — CID 99613189
4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide (PubChem CID 99613189) has the molecular formula C13H12F3N3O3S and a molecular weight of 347.32 g/mol. Its IUPAC name is 4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide.
| Compound Name | 4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 99613189 |
| Molecular Formula | C13H12F3N3O3S |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzamide |
| SMILES | O=C(NCCOCC(F)(F)F)c1ccc(-c2n[nH]c(=S)o2)cc1 |
| InChI | InChI=1S/C13H12F3N3O3S/c14-13(15,16)7-21-6-5-17-10(20)8-1-3-9(4-2-8)11-18-19-12(23)22-11/h1-4H,5-7H2,(H,17,20)(H,19,23) |
| InChIKey | OJCYWPGOEFEFDW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|