C19H24N4O2 — CID 99614878
N-[[(3R)-1-(6-ethoxypyrimidin-4-yl)piperidin-3-yl]methyl]benzamide (PubChem CID 99614878) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N-[[(3R)-1-(6-ethoxypyrimidin-4-yl)piperidin-3-yl]methyl]benzamide.
| Compound Name | N-[[(3R)-1-(6-ethoxypyrimidin-4-yl)piperidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 99614878 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N-[[(3R)-1-(6-ethoxypyrimidin-4-yl)piperidin-3-yl]methyl]benzamide |
| SMILES | CCOc1cc(N2CCC[C@H](CNC(=O)c3ccccc3)C2)ncn1 |
| InChI | InChI=1S/C19H24N4O2/c1-2-25-18-11-17(21-14-22-18)23-10-6-7-15(13-23)12-20-19(24)16-8-4-3-5-9-16/h3-5,8-9,11,14-15H,2,6-7,10,12-13H2,1H3,(H,20,24)/t15-/m1/s1 |
| InChIKey | RJFDTYQHGRVVIM-OAHLLOKOSA-N |
| XLogP | 2.52 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |