About 3-[(1R)-1-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethyl]phenol
3-[(1R)-1-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethyl]phenol (PubChem CID 99616000) has the molecular formula C15H22F2N2O
and a molecular weight of 284.35 g/mol. Its IUPAC name is 3-[(1R)-1-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethyl]phenol.
Molecular Properties
| Compound Name | 3-[(1R)-1-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethyl]phenol |
| PubChem CID | 99616000 |
| Molecular Formula | C15H22F2N2O |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 3-[(1R)-1-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethyl]phenol |
| SMILES | C[C@@H](NC1CCN(CC(F)F)CC1)c1cccc(O)c1 |
| InChI | InChI=1S/C15H22F2N2O/c1-11(12-3-2-4-14(20)9-12)18-13-5-7-19(8-6-13)10-15(16)17/h2-4,9,11,13,15,18,20H,5-8,10H2,1H3/t11-/m1/s1 |
| InChIKey | AIONZZKOPWVQTF-LLVKDONJSA-N |
| XLogP | 2.77 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(1R)-1-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R)-1-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethyl]phenol?
The IUPAC name of 3-[(1R)-1-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethyl]phenol (CID 99616000) is 3-[(1R)-1-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethyl]phenol.
What is the SMILES notation for 3-[(1R)-1-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethyl]phenol?
The canonical SMILES for 3-[(1R)-1-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethyl]phenol is C[C@@H](NC1CCN(CC(F)F)CC1)c1cccc(O)c1.
What is the InChIKey of 3-[(1R)-1-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethyl]phenol?
The InChIKey is AIONZZKOPWVQTF-LLVKDONJSA-N. The full InChI is InChI=1S/C15H22F2N2O/c1-11(12-3-2-4-14(20)9-12)18-13-5-7-19(8-6-13)10-15(16)17/h2-4,9,11,13,15,18,20H,5-8,10H2,1H3/t11-/m1/s1.
What are the key properties of 3-[(1R)-1-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethyl]phenol?
3-[(1R)-1-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethyl]phenol has a molecular weight of 284.35 g/mol, XLogP of 2.77, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R)-1-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]ethyl]phenol is sourced from PubChem (CID 99616000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).