C20H28N2O — CID 99616046
[(1S,2R)-2-[(1-benzylpyrrol-3-yl)methylamino]cycloheptyl]methanol (PubChem CID 99616046) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is [(1S,2R)-2-[(1-benzylpyrrol-3-yl)methylamino]cycloheptyl]methanol.
| Compound Name | [(1S,2R)-2-[(1-benzylpyrrol-3-yl)methylamino]cycloheptyl]methanol |
|---|---|
| PubChem CID | 99616046 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | [(1S,2R)-2-[(1-benzylpyrrol-3-yl)methylamino]cycloheptyl]methanol |
| SMILES | OC[C@H]1CCCCC[C@H]1NCc1ccn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H28N2O/c23-16-19-9-5-2-6-10-20(19)21-13-18-11-12-22(15-18)14-17-7-3-1-4-8-17/h1,3-4,7-8,11-12,15,19-21,23H,2,5-6,9-10,13-14,16H2/t19-,20-/m1/s1 |
| InChIKey | KZPDRXAOTNZSII-WOJBJXKFSA-N |
| XLogP | 3.57 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |