C16H20N2O2S — CID 99617089
N-(2,3-dihydro-1H-inden-5-yl)-N'-methyl-N'-[(3R)-thiolan-3-yl]oxamide (PubChem CID 99617089) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-N'-methyl-N'-[(3R)-thiolan-3-yl]oxamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-N'-methyl-N'-[(3R)-thiolan-3-yl]oxamide |
|---|---|
| PubChem CID | 99617089 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-N'-methyl-N'-[(3R)-thiolan-3-yl]oxamide |
| SMILES | CN(C(=O)C(=O)Nc1ccc2c(c1)CCC2)[C@@H]1CCSC1 |
| InChI | InChI=1S/C16H20N2O2S/c1-18(14-7-8-21-10-14)16(20)15(19)17-13-6-5-11-3-2-4-12(11)9-13/h5-6,9,14H,2-4,7-8,10H2,1H3,(H,17,19)/t14-/m1/s1 |
| InChIKey | IJQWKUMSFQOTAE-CQSZACIVSA-N |
| XLogP | 2.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|