About imidazo[1,2-a]pyridin-7-yl-[(3S)-3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone
imidazo[1,2-a]pyridin-7-yl-[(3S)-3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone (PubChem CID 99617785) has the molecular formula C17H18N4O2
and a molecular weight of 310.36 g/mol. Its IUPAC name is imidazo[1,2-a]pyridin-7-yl-[(3S)-3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone.
Molecular Properties
| Compound Name | imidazo[1,2-a]pyridin-7-yl-[(3S)-3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone |
| PubChem CID | 99617785 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | imidazo[1,2-a]pyridin-7-yl-[(3S)-3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone |
| SMILES | Cn1cccc1[C@H]1COCCN1C(=O)c1ccn2ccnc2c1 |
| InChI | InChI=1S/C17H18N4O2/c1-19-6-2-3-14(19)15-12-23-10-9-21(15)17(22)13-4-7-20-8-5-18-16(20)11-13/h2-8,11,15H,9-10,12H2,1H3/t15-/m1/s1 |
| InChIKey | SCKDSACDCBMKFU-OAHLLOKOSA-N |
| XLogP | 1.89 |
| TPSA | 51.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze imidazo[1,2-a]pyridin-7-yl-[(3S)-3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,2-a]pyridin-7-yl-[(3S)-3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone?
The IUPAC name of imidazo[1,2-a]pyridin-7-yl-[(3S)-3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone (CID 99617785) is imidazo[1,2-a]pyridin-7-yl-[(3S)-3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone.
What is the SMILES notation for imidazo[1,2-a]pyridin-7-yl-[(3S)-3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone?
The canonical SMILES for imidazo[1,2-a]pyridin-7-yl-[(3S)-3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone is Cn1cccc1[C@H]1COCCN1C(=O)c1ccn2ccnc2c1.
What is the InChIKey of imidazo[1,2-a]pyridin-7-yl-[(3S)-3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone?
The InChIKey is SCKDSACDCBMKFU-OAHLLOKOSA-N. The full InChI is InChI=1S/C17H18N4O2/c1-19-6-2-3-14(19)15-12-23-10-9-21(15)17(22)13-4-7-20-8-5-18-16(20)11-13/h2-8,11,15H,9-10,12H2,1H3/t15-/m1/s1.
What are the key properties of imidazo[1,2-a]pyridin-7-yl-[(3S)-3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone?
imidazo[1,2-a]pyridin-7-yl-[(3S)-3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone has a molecular weight of 310.36 g/mol, XLogP of 1.89, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-a]pyridin-7-yl-[(3S)-3-(1-methylpyrrol-2-yl)morpholin-4-yl]methanone is sourced from PubChem (CID 99617785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).