C16H19N3O2S — CID 99618792
[(2S,4R)-2,4-dimethylpiperidin-1-yl]-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]methanone (PubChem CID 99618792) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is [(2S,4R)-2,4-dimethylpiperidin-1-yl]-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]methanone.
| Compound Name | [(2S,4R)-2,4-dimethylpiperidin-1-yl]-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]methanone |
|---|---|
| PubChem CID | 99618792 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | [(2S,4R)-2,4-dimethylpiperidin-1-yl]-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]methanone |
| SMILES | C[C@@H]1CCN(C(=O)c2ccc(-c3n[nH]c(=S)o3)cc2)[C@@H](C)C1 |
| InChI | InChI=1S/C16H19N3O2S/c1-10-7-8-19(11(2)9-10)15(20)13-5-3-12(4-6-13)14-17-18-16(22)21-14/h3-6,10-11H,7-9H2,1-2H3,(H,18,22)/t10-,11+/m1/s1 |
| InChIKey | CKZSJWWLUYIBGT-MNOVXSKESA-N |
| XLogP | 3.66 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|