C15H14F3N3O2S — CID 99619402
[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]-[4-(trifluoromethyl)piperidin-1-yl]methanone (PubChem CID 99619402) has the molecular formula C15H14F3N3O2S and a molecular weight of 357.36 g/mol. Its IUPAC name is [4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]-[4-(trifluoromethyl)piperidin-1-yl]methanone.
| Compound Name | [4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]-[4-(trifluoromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 99619402 |
| Molecular Formula | C15H14F3N3O2S |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | [4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)phenyl]-[4-(trifluoromethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(-c2n[nH]c(=S)o2)cc1)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H14F3N3O2S/c16-15(17,18)11-5-7-21(8-6-11)13(22)10-3-1-9(2-4-10)12-19-20-14(24)23-12/h1-4,11H,5-8H2,(H,20,24) |
| InChIKey | DIASNZGIKFBTQD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|