About (2S)-2-[[(1S,2R)-2-(cyclohexen-1-yl)cyclohexyl]amino]propan-1-ol
(2S)-2-[[(1S,2R)-2-(cyclohexen-1-yl)cyclohexyl]amino]propan-1-ol (PubChem CID 99619852) has the molecular formula C15H27NO
and a molecular weight of 237.39 g/mol. Its IUPAC name is (2S)-2-[[(1S,2R)-2-(cyclohexen-1-yl)cyclohexyl]amino]propan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-[[(1S,2R)-2-(cyclohexen-1-yl)cyclohexyl]amino]propan-1-ol |
| PubChem CID | 99619852 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (2S)-2-[[(1S,2R)-2-(cyclohexen-1-yl)cyclohexyl]amino]propan-1-ol |
| SMILES | C[C@@H](CO)N[C@H]1CCCC[C@@H]1C1=CCCCC1 |
| InChI | InChI=1S/C15H27NO/c1-12(11-17)16-15-10-6-5-9-14(15)13-7-3-2-4-8-13/h7,12,14-17H,2-6,8-11H2,1H3/t12-,14+,15-/m0/s1 |
| InChIKey | DWZCEGNIGTVBDP-CFVMTHIKSA-N |
| XLogP | 3.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[[(1S,2R)-2-(cyclohexen-1-yl)cyclohexyl]amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[(1S,2R)-2-(cyclohexen-1-yl)cyclohexyl]amino]propan-1-ol?
The IUPAC name of (2S)-2-[[(1S,2R)-2-(cyclohexen-1-yl)cyclohexyl]amino]propan-1-ol (CID 99619852) is (2S)-2-[[(1S,2R)-2-(cyclohexen-1-yl)cyclohexyl]amino]propan-1-ol.
What is the SMILES notation for (2S)-2-[[(1S,2R)-2-(cyclohexen-1-yl)cyclohexyl]amino]propan-1-ol?
The canonical SMILES for (2S)-2-[[(1S,2R)-2-(cyclohexen-1-yl)cyclohexyl]amino]propan-1-ol is C[C@@H](CO)N[C@H]1CCCC[C@@H]1C1=CCCCC1.
What is the InChIKey of (2S)-2-[[(1S,2R)-2-(cyclohexen-1-yl)cyclohexyl]amino]propan-1-ol?
The InChIKey is DWZCEGNIGTVBDP-CFVMTHIKSA-N. The full InChI is InChI=1S/C15H27NO/c1-12(11-17)16-15-10-6-5-9-14(15)13-7-3-2-4-8-13/h7,12,14-17H,2-6,8-11H2,1H3/t12-,14+,15-/m0/s1.
What are the key properties of (2S)-2-[[(1S,2R)-2-(cyclohexen-1-yl)cyclohexyl]amino]propan-1-ol?
(2S)-2-[[(1S,2R)-2-(cyclohexen-1-yl)cyclohexyl]amino]propan-1-ol has a molecular weight of 237.39 g/mol, XLogP of 3.02, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[(1S,2R)-2-(cyclohexen-1-yl)cyclohexyl]amino]propan-1-ol is sourced from PubChem (CID 99619852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).