C16H16F3N3O2S — CID 99620529
N-cyclobutyl-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide (PubChem CID 99620529) has the molecular formula C16H16F3N3O2S and a molecular weight of 371.38 g/mol. Its IUPAC name is N-cyclobutyl-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide.
| Compound Name | N-cyclobutyl-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide |
|---|---|
| PubChem CID | 99620529 |
| Molecular Formula | C16H16F3N3O2S |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-cyclobutyl-4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-(3,3,3-trifluoropropyl)benzamide |
| SMILES | O=C(c1ccc(-c2n[nH]c(=S)o2)cc1)N(CCC(F)(F)F)C1CCC1 |
| InChI | InChI=1S/C16H16F3N3O2S/c17-16(18,19)8-9-22(12-2-1-3-12)14(23)11-6-4-10(5-7-11)13-20-21-15(25)24-13/h4-7,12H,1-3,8-9H2,(H,21,25) |
| InChIKey | CKWVZHODRCLECG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|