C18H20N2O4 — CID 99621538
5-cyclopropyl-N-[(2R)-oxan-2-yl]oxy-2-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 99621538) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 5-cyclopropyl-N-[(2R)-oxan-2-yl]oxy-2-phenyl-1,3-oxazole-4-carboxamide.
| Compound Name | 5-cyclopropyl-N-[(2R)-oxan-2-yl]oxy-2-phenyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 99621538 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 5-cyclopropyl-N-[(2R)-oxan-2-yl]oxy-2-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NO[C@@H]1CCCCO1)c1nc(-c2ccccc2)oc1C1CC1 |
| InChI | InChI=1S/C18H20N2O4/c21-17(20-24-14-8-4-5-11-22-14)15-16(12-9-10-12)23-18(19-15)13-6-2-1-3-7-13/h1-3,6-7,12,14H,4-5,8-11H2,(H,20,21)/t14-/m1/s1 |
| InChIKey | JVULNSFIMGMDKC-CQSZACIVSA-N |
| XLogP | 3.41 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|