About 1-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea
1-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea (PubChem CID 99621933) has the molecular formula C10H17F3N2O2
and a molecular weight of 254.25 g/mol. Its IUPAC name is 1-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea.
Molecular Properties
| Compound Name | 1-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea |
| PubChem CID | 99621933 |
| Molecular Formula | C10H17F3N2O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea |
| SMILES | CCONC(=O)N[C@H](C1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O2/c1-2-17-15-9(16)14-8(10(11,12)13)7-5-3-4-6-7/h7-8H,2-6H2,1H3,(H2,14,15,16)/t8-/m1/s1 |
| InChIKey | GLAFSZSEEJHMST-MRVPVSSYSA-N |
| XLogP | 2.36 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea?
The IUPAC name of 1-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea (CID 99621933) is 1-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea.
What is the SMILES notation for 1-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea?
The canonical SMILES for 1-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea is CCONC(=O)N[C@H](C1CCCC1)C(F)(F)F.
What is the InChIKey of 1-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea?
The InChIKey is GLAFSZSEEJHMST-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H17F3N2O2/c1-2-17-15-9(16)14-8(10(11,12)13)7-5-3-4-6-7/h7-8H,2-6H2,1H3,(H2,14,15,16)/t8-/m1/s1.
What are the key properties of 1-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea?
1-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea has a molecular weight of 254.25 g/mol, XLogP of 2.36, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R)-1-cyclopentyl-2,2,2-trifluoroethyl]-3-ethoxyurea is sourced from PubChem (CID 99621933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).