C14H14F3N3O2S — CID 99622574
4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-(5,5,5-trifluoropentyl)benzamide (PubChem CID 99622574) has the molecular formula C14H14F3N3O2S and a molecular weight of 345.35 g/mol. Its IUPAC name is 4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-(5,5,5-trifluoropentyl)benzamide.
| Compound Name | 4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-(5,5,5-trifluoropentyl)benzamide |
|---|---|
| PubChem CID | 99622574 |
| Molecular Formula | C14H14F3N3O2S |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)-N-(5,5,5-trifluoropentyl)benzamide |
| SMILES | O=C(NCCCCC(F)(F)F)c1ccc(-c2n[nH]c(=S)o2)cc1 |
| InChI | InChI=1S/C14H14F3N3O2S/c15-14(16,17)7-1-2-8-18-11(21)9-3-5-10(6-4-9)12-19-20-13(23)22-12/h3-6H,1-2,7-8H2,(H,18,21)(H,20,23) |
| InChIKey | ZWBNUNHCCBDIEA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|