About 3-bromo-N,5-dimethyl-N-(1-oxothian-4-yl)benzamide
3-bromo-N,5-dimethyl-N-(1-oxothian-4-yl)benzamide (PubChem CID 99623716) has the molecular formula C14H18BrNO2S
and a molecular weight of 344.27 g/mol. Its IUPAC name is 3-bromo-N,5-dimethyl-N-(1-oxothian-4-yl)benzamide.
Molecular Properties
| Compound Name | 3-bromo-N,5-dimethyl-N-(1-oxothian-4-yl)benzamide |
| PubChem CID | 99623716 |
| Molecular Formula | C14H18BrNO2S |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 3-bromo-N,5-dimethyl-N-(1-oxothian-4-yl)benzamide |
| SMILES | Cc1cc(Br)cc(C(=O)N(C)C2CCS(=O)CC2)c1 |
| InChI | InChI=1S/C14H18BrNO2S/c1-10-7-11(9-12(15)8-10)14(17)16(2)13-3-5-19(18)6-4-13/h7-9,13H,3-6H2,1-2H3 |
| InChIKey | VFAPHBKELQSECZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-N,5-dimethyl-N-(1-oxothian-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N,5-dimethyl-N-(1-oxothian-4-yl)benzamide?
The IUPAC name of 3-bromo-N,5-dimethyl-N-(1-oxothian-4-yl)benzamide (CID 99623716) is 3-bromo-N,5-dimethyl-N-(1-oxothian-4-yl)benzamide.
What is the SMILES notation for 3-bromo-N,5-dimethyl-N-(1-oxothian-4-yl)benzamide?
The canonical SMILES for 3-bromo-N,5-dimethyl-N-(1-oxothian-4-yl)benzamide is Cc1cc(Br)cc(C(=O)N(C)C2CCS(=O)CC2)c1.
What is the InChIKey of 3-bromo-N,5-dimethyl-N-(1-oxothian-4-yl)benzamide?
The InChIKey is VFAPHBKELQSECZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrNO2S/c1-10-7-11(9-12(15)8-10)14(17)16(2)13-3-5-19(18)6-4-13/h7-9,13H,3-6H2,1-2H3.
What are the key properties of 3-bromo-N,5-dimethyl-N-(1-oxothian-4-yl)benzamide?
3-bromo-N,5-dimethyl-N-(1-oxothian-4-yl)benzamide has a molecular weight of 344.27 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N,5-dimethyl-N-(1-oxothian-4-yl)benzamide is sourced from PubChem (CID 99623716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).