About 3-[3-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]pyrazol-1-yl]propanamide
3-[3-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]pyrazol-1-yl]propanamide (PubChem CID 99623761) has the molecular formula C13H19F3N4O
and a molecular weight of 304.32 g/mol. Its IUPAC name is 3-[3-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]pyrazol-1-yl]propanamide.
Molecular Properties
| Compound Name | 3-[3-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]pyrazol-1-yl]propanamide |
| PubChem CID | 99623761 |
| Molecular Formula | C13H19F3N4O |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 3-[3-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]pyrazol-1-yl]propanamide |
| SMILES | NC(=O)CCn1ccc(N[C@H]2CCC[C@@H](C(F)(F)F)C2)n1 |
| InChI | InChI=1S/C13H19F3N4O/c14-13(15,16)9-2-1-3-10(8-9)18-12-5-7-20(19-12)6-4-11(17)21/h5,7,9-10H,1-4,6,8H2,(H2,17,21)(H,18,19)/t9-,10+/m1/s1 |
| InChIKey | QAPCWBLUMNXEEU-ZJUUUORDSA-N |
| XLogP | 2.29 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]pyrazol-1-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]pyrazol-1-yl]propanamide?
The IUPAC name of 3-[3-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]pyrazol-1-yl]propanamide (CID 99623761) is 3-[3-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]pyrazol-1-yl]propanamide.
What is the SMILES notation for 3-[3-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]pyrazol-1-yl]propanamide?
The canonical SMILES for 3-[3-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]pyrazol-1-yl]propanamide is NC(=O)CCn1ccc(N[C@H]2CCC[C@@H](C(F)(F)F)C2)n1.
What is the InChIKey of 3-[3-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]pyrazol-1-yl]propanamide?
The InChIKey is QAPCWBLUMNXEEU-ZJUUUORDSA-N. The full InChI is InChI=1S/C13H19F3N4O/c14-13(15,16)9-2-1-3-10(8-9)18-12-5-7-20(19-12)6-4-11(17)21/h5,7,9-10H,1-4,6,8H2,(H2,17,21)(H,18,19)/t9-,10+/m1/s1.
What are the key properties of 3-[3-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]pyrazol-1-yl]propanamide?
3-[3-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]pyrazol-1-yl]propanamide has a molecular weight of 304.32 g/mol, XLogP of 2.29, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[[(1S,3R)-3-(trifluoromethyl)cyclohexyl]amino]pyrazol-1-yl]propanamide is sourced from PubChem (CID 99623761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).