C14H20BrN3O2 — CID 99624141
1-(5-bromo-6-methyl-2-pyridinyl)-3-[(2R,6S)-2,6-dimethyloxan-4-yl]urea (PubChem CID 99624141) has the molecular formula C14H20BrN3O2 and a molecular weight of 342.24 g/mol. Its IUPAC name is 1-(5-bromo-6-methyl-2-pyridinyl)-3-[(2R,6S)-2,6-dimethyloxan-4-yl]urea.
| Compound Name | 1-(5-bromo-6-methyl-2-pyridinyl)-3-[(2R,6S)-2,6-dimethyloxan-4-yl]urea |
|---|---|
| PubChem CID | 99624141 |
| Molecular Formula | C14H20BrN3O2 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 1-(5-bromo-6-methyl-2-pyridinyl)-3-[(2R,6S)-2,6-dimethyloxan-4-yl]urea |
| SMILES | Cc1nc(NC(=O)NC2C[C@@H](C)O[C@@H](C)C2)ccc1Br |
| InChI | InChI=1S/C14H20BrN3O2/c1-8-6-11(7-9(2)20-8)17-14(19)18-13-5-4-12(15)10(3)16-13/h4-5,8-9,11H,6-7H2,1-3H3,(H2,16,17,18,19)/t8-,9+,11? |
| InChIKey | IQQCYJHSWARAQI-SLHIUPAKSA-N |
| XLogP | 3.23 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |