C15H23F3N4 — CID 99625175
cis-(1S,3R)-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-3-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 99625175) has the molecular formula C15H23F3N4 and a molecular weight of 316.37 g/mol. Its IUPAC name is cis-(1S,3R)-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-3-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | cis-(1S,3R)-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-3-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 99625175 |
| Molecular Formula | C15H23F3N4 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | cis-(1S,3R)-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)-3-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | FC(F)(F)[C@@H]1CCC[C@H](NCc2nnc3n2CCCCC3)C1 |
| InChI | InChI=1S/C15H23F3N4/c16-15(17,18)11-5-4-6-12(9-11)19-10-14-21-20-13-7-2-1-3-8-22(13)14/h11-12,19H,1-10H2/t11-,12+/m1/s1 |
| InChIKey | SSEJVMFFPXUXBF-NEPJUHHUSA-N |
| XLogP | 3.22 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |