C16H12Cl2N4OS — CID 99626923
2,5-dichloro-N-[5-(2,4-dimethylphenyl)-1,3,4-thiadiazol-2-yl]pyridine-4-carboxamide (PubChem CID 99626923) has the molecular formula C16H12Cl2N4OS and a molecular weight of 379.27 g/mol. Its IUPAC name is 2,5-dichloro-N-[5-(2,4-dimethylphenyl)-1,3,4-thiadiazol-2-yl]pyridine-4-carboxamide.
| Compound Name | 2,5-dichloro-N-[5-(2,4-dimethylphenyl)-1,3,4-thiadiazol-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 99626923 |
| Molecular Formula | C16H12Cl2N4OS |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 2,5-dichloro-N-[5-(2,4-dimethylphenyl)-1,3,4-thiadiazol-2-yl]pyridine-4-carboxamide |
| SMILES | Cc1ccc(-c2nnc(NC(=O)c3cc(Cl)ncc3Cl)s2)c(C)c1 |
| InChI | InChI=1S/C16H12Cl2N4OS/c1-8-3-4-10(9(2)5-8)15-21-22-16(24-15)20-14(23)11-6-13(18)19-7-12(11)17/h3-7H,1-2H3,(H,20,22,23) |
| InChIKey | IKGPLVPAHQIQFE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|