C15H20N4O2S2 — CID 99629136
(2R)-N-[(1R,2S)-2-hydroxycyclohexyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 99629136) has the molecular formula C15H20N4O2S2 and a molecular weight of 352.49 g/mol. Its IUPAC name is (2R)-N-[(1R,2S)-2-hydroxycyclohexyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | (2R)-N-[(1R,2S)-2-hydroxycyclohexyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 99629136 |
| Molecular Formula | C15H20N4O2S2 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | (2R)-N-[(1R,2S)-2-hydroxycyclohexyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | C[C@H](C(=O)N[C@@H]1CCCC[C@@H]1O)n1c(-c2cccs2)n[nH]c1=S |
| InChI | InChI=1S/C15H20N4O2S2/c1-9(14(21)16-10-5-2-3-6-11(10)20)19-13(17-18-15(19)22)12-7-4-8-23-12/h4,7-11,20H,2-3,5-6H2,1H3,(H,16,21)(H,18,22)/t9-,10-,11+/m1/s1 |
| InChIKey | NDHCULMULBBVPL-MXWKQRLJSA-N |
| XLogP | 2.65 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|