About N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-6-(2-methylimidazol-1-yl)pyrazin-2-amine
N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-6-(2-methylimidazol-1-yl)pyrazin-2-amine (PubChem CID 99630162) has the molecular formula C17H16FN5S
and a molecular weight of 341.42 g/mol. Its IUPAC name is N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-6-(2-methylimidazol-1-yl)pyrazin-2-amine.
Molecular Properties
| Compound Name | N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-6-(2-methylimidazol-1-yl)pyrazin-2-amine |
| PubChem CID | 99630162 |
| Molecular Formula | C17H16FN5S |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-6-(2-methylimidazol-1-yl)pyrazin-2-amine |
| SMILES | Cc1nccn1-c1cncc(N[C@H]2CCSc3ccc(F)cc32)n1 |
| InChI | InChI=1S/C17H16FN5S/c1-11-20-5-6-23(11)17-10-19-9-16(22-17)21-14-4-7-24-15-3-2-12(18)8-13(14)15/h2-3,5-6,8-10,14H,4,7H2,1H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | CUIHMAHYLGQSPG-AWEZNQCLSA-N |
| XLogP | 3.76 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-6-(2-methylimidazol-1-yl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-6-(2-methylimidazol-1-yl)pyrazin-2-amine?
The IUPAC name of N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-6-(2-methylimidazol-1-yl)pyrazin-2-amine (CID 99630162) is N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-6-(2-methylimidazol-1-yl)pyrazin-2-amine.
What is the SMILES notation for N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-6-(2-methylimidazol-1-yl)pyrazin-2-amine?
The canonical SMILES for N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-6-(2-methylimidazol-1-yl)pyrazin-2-amine is Cc1nccn1-c1cncc(N[C@H]2CCSc3ccc(F)cc32)n1.
What is the InChIKey of N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-6-(2-methylimidazol-1-yl)pyrazin-2-amine?
The InChIKey is CUIHMAHYLGQSPG-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H16FN5S/c1-11-20-5-6-23(11)17-10-19-9-16(22-17)21-14-4-7-24-15-3-2-12(18)8-13(14)15/h2-3,5-6,8-10,14H,4,7H2,1H3,(H,21,22)/t14-/m0/s1.
What are the key properties of N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-6-(2-methylimidazol-1-yl)pyrazin-2-amine?
N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-6-(2-methylimidazol-1-yl)pyrazin-2-amine has a molecular weight of 341.42 g/mol, XLogP of 3.76, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4S)-6-fluoro-3,4-dihydro-2H-thiochromen-4-yl]-6-(2-methylimidazol-1-yl)pyrazin-2-amine is sourced from PubChem (CID 99630162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).