C16H20FN3O2 — CID 99630725
2-fluoro-6-hydroxy-N-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]benzamide (PubChem CID 99630725) has the molecular formula C16H20FN3O2 and a molecular weight of 305.35 g/mol. Its IUPAC name is 2-fluoro-6-hydroxy-N-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]benzamide.
| Compound Name | 2-fluoro-6-hydroxy-N-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]benzamide |
|---|---|
| PubChem CID | 99630725 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 2-fluoro-6-hydroxy-N-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]benzamide |
| SMILES | Cc1nn(C)c(C)c1CCCNC(=O)c1c(O)cccc1F |
| InChI | InChI=1S/C16H20FN3O2/c1-10-12(11(2)20(3)19-10)6-5-9-18-16(22)15-13(17)7-4-8-14(15)21/h4,7-8,21H,5-6,9H2,1-3H3,(H,18,22) |
| InChIKey | BHHCBXXVNCBXMA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|