C15H9BrF3N3O — CID 99630840
3-bromo-N-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]aniline (PubChem CID 99630840) has the molecular formula C15H9BrF3N3O and a molecular weight of 384.16 g/mol. Its IUPAC name is 3-bromo-N-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]aniline.
| Compound Name | 3-bromo-N-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]aniline |
|---|---|
| PubChem CID | 99630840 |
| Molecular Formula | C15H9BrF3N3O |
| Molecular Weight | 384.16 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | 3-bromo-N-[[3-(3,4,5-trifluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]aniline |
| SMILES | Fc1cc(-c2noc(CNc3cccc(Br)c3)n2)cc(F)c1F |
| InChI | InChI=1S/C15H9BrF3N3O/c16-9-2-1-3-10(6-9)20-7-13-21-15(22-23-13)8-4-11(17)14(19)12(18)5-8/h1-6,20H,7H2 |
| InChIKey | APUFCLMJZZCCIX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.16 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|