About (3S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(1-methylpyrrol-2-yl)morpholine
(3S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(1-methylpyrrol-2-yl)morpholine (PubChem CID 99631304) has the molecular formula C17H20N4O
and a molecular weight of 296.37 g/mol. Its IUPAC name is (3S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(1-methylpyrrol-2-yl)morpholine.
Molecular Properties
| Compound Name | (3S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(1-methylpyrrol-2-yl)morpholine |
| PubChem CID | 99631304 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (3S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(1-methylpyrrol-2-yl)morpholine |
| SMILES | Cn1cccc1[C@H]1COCCN1Cc1cn2ccccc2n1 |
| InChI | InChI=1S/C17H20N4O/c1-19-7-4-5-15(19)16-13-22-10-9-20(16)11-14-12-21-8-3-2-6-17(21)18-14/h2-8,12,16H,9-11,13H2,1H3/t16-/m1/s1 |
| InChIKey | CVMGUTVTHXDVNZ-MRXNPFEDSA-N |
| XLogP | 2.25 |
| TPSA | 34.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(1-methylpyrrol-2-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(1-methylpyrrol-2-yl)morpholine?
The IUPAC name of (3S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(1-methylpyrrol-2-yl)morpholine (CID 99631304) is (3S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(1-methylpyrrol-2-yl)morpholine.
What is the SMILES notation for (3S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(1-methylpyrrol-2-yl)morpholine?
The canonical SMILES for (3S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(1-methylpyrrol-2-yl)morpholine is Cn1cccc1[C@H]1COCCN1Cc1cn2ccccc2n1.
What is the InChIKey of (3S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(1-methylpyrrol-2-yl)morpholine?
The InChIKey is CVMGUTVTHXDVNZ-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H20N4O/c1-19-7-4-5-15(19)16-13-22-10-9-20(16)11-14-12-21-8-3-2-6-17(21)18-14/h2-8,12,16H,9-11,13H2,1H3/t16-/m1/s1.
What are the key properties of (3S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(1-methylpyrrol-2-yl)morpholine?
(3S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(1-methylpyrrol-2-yl)morpholine has a molecular weight of 296.37 g/mol, XLogP of 2.25, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-4-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-(1-methylpyrrol-2-yl)morpholine is sourced from PubChem (CID 99631304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).