C15H19FN2O3 — CID 99631822
N-[(1R)-2-amino-1-(4-fluorophenyl)-2-oxoethyl]-3-[(3S)-oxolan-3-yl]propanamide (PubChem CID 99631822) has the molecular formula C15H19FN2O3 and a molecular weight of 294.33 g/mol. Its IUPAC name is N-[(1R)-2-amino-1-(4-fluorophenyl)-2-oxoethyl]-3-[(3S)-oxolan-3-yl]propanamide.
| Compound Name | N-[(1R)-2-amino-1-(4-fluorophenyl)-2-oxoethyl]-3-[(3S)-oxolan-3-yl]propanamide |
|---|---|
| PubChem CID | 99631822 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-[(1R)-2-amino-1-(4-fluorophenyl)-2-oxoethyl]-3-[(3S)-oxolan-3-yl]propanamide |
| SMILES | NC(=O)[C@H](NC(=O)CC[C@H]1CCOC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FN2O3/c16-12-4-2-11(3-5-12)14(15(17)20)18-13(19)6-1-10-7-8-21-9-10/h2-5,10,14H,1,6-9H2,(H2,17,20)(H,18,19)/t10-,14+/m0/s1 |
| InChIKey | PUDVASNDYPIXRY-IINYFYTJSA-N |
| XLogP | 1.28 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |